ChemNet > CAS > 5617-74-3 3-Oxabicyclo[3.1.0]hexane-2,4-dione
5617-74-3 3-Oxabicyclo[3.1.0]hexane-2,4-dione
| product Name |
3-Oxabicyclo[3.1.0]hexane-2,4-dione |
| CAS No |
5617-74-3 |
| Synonyms |
1,2-Cyclopropanedicarboxylic anhydride |
| Molecular Formula |
C5H4O3 |
| Molecular Weight |
112.0835 |
| InChI |
InChI=1/C5H4O3/c6-4-2-1-3(2)5(7)8-4/h2-3H,1H2 |
| Molecular Structure |
![5617-74-3 3-Oxabicyclo[3.1.0]hexane-2,4-dione](https://images-a.chemnet.com/suppliers/chembase/664/116664_1.gif)
|
| Density |
1.567g/cm3 |
| Melting point |
59-61℃ |
| Boiling point |
280.5°C at 760 mmHg |
| Refractive index |
1.555 |
| Flash point |
143.3°C |
| Vapour Pressur |
0.00378mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|
